C12H21N5O2S2 — CID 57309109
N'-[2-[[2-[(dimethylamino)methyl]-1,3-thiazol-4-yl]methylsulfanyl]ethyl]-2-nitropropanimidamide (PubChem CID 57309109) has the molecular formula C12H21N5O2S2 and a molecular weight of 331.47 g/mol. Its IUPAC name is N'-[2-[[2-[(dimethylamino)methyl]-1,3-thiazol-4-yl]methylsulfanyl]ethyl]-2-nitropropanimidamide.
| Compound Name | N'-[2-[[2-[(dimethylamino)methyl]-1,3-thiazol-4-yl]methylsulfanyl]ethyl]-2-nitropropanimidamide |
|---|---|
| PubChem CID | 57309109 |
| Molecular Formula | C12H21N5O2S2 |
| Molecular Weight | 331.47 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | N'-[2-[[2-[(dimethylamino)methyl]-1,3-thiazol-4-yl]methylsulfanyl]ethyl]-2-nitropropanimidamide |
| SMILES | CC(/C(N)=N/CCSCc1csc(CN(C)C)n1)[N+](=O)[O-] |
| InChI | InChI=1S/C12H21N5O2S2/c1-9(17(18)19)12(13)14-4-5-20-7-10-8-21-11(15-10)6-16(2)3/h8-9H,4-7H2,1-3H3,(H2,13,14) |
| InChIKey | WMGXLHRJRCFHPW-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.47 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|