C11H21N5O2S2 — CID 158056315
1-N'-[[2-[(dimethylamino)methyl]-1,3-thiazol-4-yl]methylsulfanyl]-1-N-ethyl-2-nitroethane-1,1-diamine (PubChem CID 158056315) has the molecular formula C11H21N5O2S2 and a molecular weight of 319.46 g/mol. Its IUPAC name is 1-N'-[[2-[(dimethylamino)methyl]-1,3-thiazol-4-yl]methylsulfanyl]-1-N-ethyl-2-nitroethane-1,1-diamine.
| Compound Name | 1-N'-[[2-[(dimethylamino)methyl]-1,3-thiazol-4-yl]methylsulfanyl]-1-N-ethyl-2-nitroethane-1,1-diamine |
|---|---|
| PubChem CID | 158056315 |
| Molecular Formula | C11H21N5O2S2 |
| Molecular Weight | 319.46 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 1-N'-[[2-[(dimethylamino)methyl]-1,3-thiazol-4-yl]methylsulfanyl]-1-N-ethyl-2-nitroethane-1,1-diamine |
| SMILES | CCNC(C[N+](=O)[O-])NSCc1csc(CN(C)C)n1 |
| InChI | InChI=1S/C11H21N5O2S2/c1-4-12-10(5-16(17)18)14-20-8-9-7-19-11(13-9)6-15(2)3/h7,10,12,14H,4-6,8H2,1-3H3 |
| InChIKey | FKCDMGYDANCSEC-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 83.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.46 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|