C12H23N5O2S3 — CID 173155448
(E)-1-N'-[2-[[2-[(dimethylamino)methyl]-1,3-thiazol-4-yl]methylsulfanyl]ethyl]-1-N-methyl-2-nitroethene-1,1-diamine;sulfane (PubChem CID 173155448) has the molecular formula C12H23N5O2S3 and a molecular weight of 365.55 g/mol. Its IUPAC name is (E)-1-N'-[2-[[2-[(dimethylamino)methyl]-1,3-thiazol-4-yl]methylsulfanyl]ethyl]-1-N-methyl-2-nitroethene-1,1-diamine;sulfane.
| Compound Name | (E)-1-N'-[2-[[2-[(dimethylamino)methyl]-1,3-thiazol-4-yl]methylsulfanyl]ethyl]-1-N-methyl-2-nitroethene-1,1-diamine;sulfane |
|---|---|
| PubChem CID | 173155448 |
| Molecular Formula | C12H23N5O2S3 |
| Molecular Weight | 365.55 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | (E)-1-N'-[2-[[2-[(dimethylamino)methyl]-1,3-thiazol-4-yl]methylsulfanyl]ethyl]-1-N-methyl-2-nitroethene-1,1-diamine;sulfane |
| SMILES | CN/C(=C\[N+](=O)[O-])NCCSCc1csc(CN(C)C)n1.S |
| InChI | InChI=1S/C12H21N5O2S2.H2S/c1-13-11(6-17(18)19)14-4-5-20-8-10-9-21-12(15-10)7-16(2)3;/h6,9,13-14H,4-5,7-8H2,1-3H3;1H2/b11-6+; |
| InChIKey | NTHFWLQDGNNIDF-ICSBZGNSSA-N |
| XLogP | 1.44 |
| TPSA | 83.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.55 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|