C13H23N5O3S2 — CID 70485102
1-N-[3-[[2-(aminomethyl)-1,3-thiazol-4-yl]methylsulfanyl]propyl]-1-N'-(1-methoxyethyl)-2-nitroethene-1,1-diamine (PubChem CID 70485102) has the molecular formula C13H23N5O3S2 and a molecular weight of 361.49 g/mol. Its IUPAC name is 1-N-[3-[[2-(aminomethyl)-1,3-thiazol-4-yl]methylsulfanyl]propyl]-1-N'-(1-methoxyethyl)-2-nitroethene-1,1-diamine.
| Compound Name | 1-N-[3-[[2-(aminomethyl)-1,3-thiazol-4-yl]methylsulfanyl]propyl]-1-N'-(1-methoxyethyl)-2-nitroethene-1,1-diamine |
|---|---|
| PubChem CID | 70485102 |
| Molecular Formula | C13H23N5O3S2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 1-N-[3-[[2-(aminomethyl)-1,3-thiazol-4-yl]methylsulfanyl]propyl]-1-N'-(1-methoxyethyl)-2-nitroethene-1,1-diamine |
| SMILES | COC(C)NC(=C[N+](=O)[O-])NCCCSCc1csc(CN)n1 |
| InChI | InChI=1S/C13H23N5O3S2/c1-10(21-2)16-12(7-18(19)20)15-4-3-5-22-8-11-9-23-13(6-14)17-11/h7,9-10,15-16H,3-6,8,14H2,1-2H3 |
| InChIKey | WYMJRHRKIVZIIC-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 115.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|