C10H18ClN5O2S2 — CID 173321756
(E)-1-N-methyl-1-N'-[2-[[2-(methylamino)-1,3-thiazol-4-yl]methylsulfanyl]ethyl]-2-nitroethene-1,1-diamine;hydrochloride (PubChem CID 173321756) has the molecular formula C10H18ClN5O2S2 and a molecular weight of 339.87 g/mol. Its IUPAC name is (E)-1-N-methyl-1-N'-[2-[[2-(methylamino)-1,3-thiazol-4-yl]methylsulfanyl]ethyl]-2-nitroethene-1,1-diamine;hydrochloride.
| Compound Name | (E)-1-N-methyl-1-N'-[2-[[2-(methylamino)-1,3-thiazol-4-yl]methylsulfanyl]ethyl]-2-nitroethene-1,1-diamine;hydrochloride |
|---|---|
| PubChem CID | 173321756 |
| Molecular Formula | C10H18ClN5O2S2 |
| Molecular Weight | 339.87 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | (E)-1-N-methyl-1-N'-[2-[[2-(methylamino)-1,3-thiazol-4-yl]methylsulfanyl]ethyl]-2-nitroethene-1,1-diamine;hydrochloride |
| SMILES | CN/C(=C\[N+](=O)[O-])NCCSCc1csc(NC)n1.Cl |
| InChI | InChI=1S/C10H17N5O2S2.ClH/c1-11-9(5-15(16)17)13-3-4-18-6-8-7-19-10(12-2)14-8;/h5,7,11,13H,3-4,6H2,1-2H3,(H,12,14);1H/b9-5+; |
| InChIKey | XWUBPKCFTNEXFR-SZKNIZGXSA-N |
| XLogP | 1.72 |
| TPSA | 92.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.87 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|