C13H18N6O2S2 — CID 139789732
1-N-methyl-2-nitro-1-N'-[2-[[2-(1H-pyrazol-5-ylmethyl)-1,3-thiazol-4-yl]methylsulfanyl]ethyl]ethene-1,1-diamine (PubChem CID 139789732) has the molecular formula C13H18N6O2S2 and a molecular weight of 354.46 g/mol. Its IUPAC name is 1-N-methyl-2-nitro-1-N'-[2-[[2-(1H-pyrazol-5-ylmethyl)-1,3-thiazol-4-yl]methylsulfanyl]ethyl]ethene-1,1-diamine.
| Compound Name | 1-N-methyl-2-nitro-1-N'-[2-[[2-(1H-pyrazol-5-ylmethyl)-1,3-thiazol-4-yl]methylsulfanyl]ethyl]ethene-1,1-diamine |
|---|---|
| PubChem CID | 139789732 |
| Molecular Formula | C13H18N6O2S2 |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 1-N-methyl-2-nitro-1-N'-[2-[[2-(1H-pyrazol-5-ylmethyl)-1,3-thiazol-4-yl]methylsulfanyl]ethyl]ethene-1,1-diamine |
| SMILES | CNC(=C[N+](=O)[O-])NCCSCc1csc(Cc2ccn[nH]2)n1 |
| InChI | InChI=1S/C13H18N6O2S2/c1-14-12(7-19(20)21)15-4-5-22-8-11-9-23-13(17-11)6-10-2-3-16-18-10/h2-3,7,9,14-15H,4-6,8H2,1H3,(H,16,18) |
| InChIKey | AAIGCTDYKPTEIC-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 108.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|