C11H15BrN4O2S — CID 21435082
(Z)-1-N'-[2-[(3-bromo-2-pyridinyl)methylsulfanyl]ethyl]-1-N-methyl-2-nitroethene-1,1-diamine (PubChem CID 21435082) has the molecular formula C11H15BrN4O2S and a molecular weight of 347.24 g/mol. Its IUPAC name is (Z)-1-N'-[2-[(3-bromo-2-pyridinyl)methylsulfanyl]ethyl]-1-N-methyl-2-nitroethene-1,1-diamine.
| Compound Name | (Z)-1-N'-[2-[(3-bromo-2-pyridinyl)methylsulfanyl]ethyl]-1-N-methyl-2-nitroethene-1,1-diamine |
|---|---|
| PubChem CID | 21435082 |
| Molecular Formula | C11H15BrN4O2S |
| Molecular Weight | 347.24 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | (Z)-1-N'-[2-[(3-bromo-2-pyridinyl)methylsulfanyl]ethyl]-1-N-methyl-2-nitroethene-1,1-diamine |
| SMILES | CN/C(=C/[N+](=O)[O-])NCCSCc1ncccc1Br |
| InChI | InChI=1S/C11H15BrN4O2S/c1-13-11(7-16(17)18)15-5-6-19-8-10-9(12)3-2-4-14-10/h2-4,7,13,15H,5-6,8H2,1H3/b11-7- |
| InChIKey | OHVKWZBKAWNPBK-XFFZJAGNSA-N |
| XLogP | 1.96 |
| TPSA | 80.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.24 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|