C17H21BrClN5O2S3 — CID 70624177
1-N'-[2-[(4-bromo-3-methyl-1,2-thiazol-5-yl)methylsulfanyl]ethyl]-1-N-[2-[(3-chloro-2-pyridinyl)methylsulfanyl]ethyl]-2-nitroethene-1,1-diamine (PubChem CID 70624177) has the molecular formula C17H21BrClN5O2S3 and a molecular weight of 538.95 g/mol. Its IUPAC name is 1-N'-[2-[(4-bromo-3-methyl-1,2-thiazol-5-yl)methylsulfanyl]ethyl]-1-N-[2-[(3-chloro-2-pyridinyl)methylsulfanyl]ethyl]-2-nitroethene-1,1-diamine.
| Compound Name | 1-N'-[2-[(4-bromo-3-methyl-1,2-thiazol-5-yl)methylsulfanyl]ethyl]-1-N-[2-[(3-chloro-2-pyridinyl)methylsulfanyl]ethyl]-2-nitroethene-1,1-diamine |
|---|---|
| PubChem CID | 70624177 |
| Molecular Formula | C17H21BrClN5O2S3 |
| Molecular Weight | 538.95 g/mol |
| Exact Mass | 536.97 |
| IUPAC Name | 1-N'-[2-[(4-bromo-3-methyl-1,2-thiazol-5-yl)methylsulfanyl]ethyl]-1-N-[2-[(3-chloro-2-pyridinyl)methylsulfanyl]ethyl]-2-nitroethene-1,1-diamine |
| SMILES | Cc1nsc(CSCCNC(=C[N+](=O)[O-])NCCSCc2ncccc2Cl)c1Br |
| InChI | InChI=1S/C17H21BrClN5O2S3/c1-12-17(18)15(29-23-12)11-28-8-6-22-16(9-24(25)26)21-5-7-27-10-14-13(19)3-2-4-20-14/h2-4,9,21-22H,5-8,10-11H2,1H3 |
| InChIKey | VOKIKQJZQKEJJJ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 92.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.95 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|