C16H19BrClN5O2S3 — CID 163662139
1-N'-[2-[(4-bromo-1,2-thiazol-3-yl)methylsulfanyl]ethyl]-1-N-[2-[(3-chloro-2-pyridinyl)methylsulfanyl]ethyl]-2-nitroethene-1,1-diamine (PubChem CID 163662139) has the molecular formula C16H19BrClN5O2S3 and a molecular weight of 524.92 g/mol. Its IUPAC name is 1-N'-[2-[(4-bromo-1,2-thiazol-3-yl)methylsulfanyl]ethyl]-1-N-[2-[(3-chloro-2-pyridinyl)methylsulfanyl]ethyl]-2-nitroethene-1,1-diamine.
| Compound Name | 1-N'-[2-[(4-bromo-1,2-thiazol-3-yl)methylsulfanyl]ethyl]-1-N-[2-[(3-chloro-2-pyridinyl)methylsulfanyl]ethyl]-2-nitroethene-1,1-diamine |
|---|---|
| PubChem CID | 163662139 |
| Molecular Formula | C16H19BrClN5O2S3 |
| Molecular Weight | 524.92 g/mol |
| Exact Mass | 522.96 |
| IUPAC Name | 1-N'-[2-[(4-bromo-1,2-thiazol-3-yl)methylsulfanyl]ethyl]-1-N-[2-[(3-chloro-2-pyridinyl)methylsulfanyl]ethyl]-2-nitroethene-1,1-diamine |
| SMILES | O=[N+]([O-])C=C(NCCSCc1ncccc1Cl)NCCSCc1nscc1Br |
| InChI | InChI=1S/C16H19BrClN5O2S3/c17-12-9-28-22-14(12)10-26-6-4-20-16(8-23(24)25)21-5-7-27-11-15-13(18)2-1-3-19-15/h1-3,8-9,20-21H,4-7,10-11H2 |
| InChIKey | IVHPMUXYBICPGN-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 92.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.92 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|