C17H23ClN6O2S2 — CID 70623823
1-N'-[2-[(3-chloro-2-pyridinyl)methylsulfanyl]ethyl]-1-N-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-2-nitroethene-1,1-diamine (PubChem CID 70623823) has the molecular formula C17H23ClN6O2S2 and a molecular weight of 443.00 g/mol. Its IUPAC name is 1-N'-[2-[(3-chloro-2-pyridinyl)methylsulfanyl]ethyl]-1-N-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-2-nitroethene-1,1-diamine.
| Compound Name | 1-N'-[2-[(3-chloro-2-pyridinyl)methylsulfanyl]ethyl]-1-N-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-2-nitroethene-1,1-diamine |
|---|---|
| PubChem CID | 70623823 |
| Molecular Formula | C17H23ClN6O2S2 |
| Molecular Weight | 443.00 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | 1-N'-[2-[(3-chloro-2-pyridinyl)methylsulfanyl]ethyl]-1-N-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-2-nitroethene-1,1-diamine |
| SMILES | Cc1[nH]cnc1CSCCNC(=C[N+](=O)[O-])NCCSCc1ncccc1Cl |
| InChI | InChI=1S/C17H23ClN6O2S2/c1-13-15(23-12-22-13)10-27-7-5-20-17(9-24(25)26)21-6-8-28-11-16-14(18)3-2-4-19-16/h2-4,9,12,20-21H,5-8,10-11H2,1H3,(H,22,23) |
| InChIKey | AIAVTBBCGPVTLW-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 108.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.00 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imidazole_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|