C12H14ClF3N4O2S — CID 70508656
1-N-[2-[(3-chloro-2-pyridinyl)methylsulfanyl]ethyl]-2-nitro-1-N'-(2,2,2-trifluoroethyl)ethene-1,1-diamine (PubChem CID 70508656) has the molecular formula C12H14ClF3N4O2S and a molecular weight of 370.78 g/mol. Its IUPAC name is 1-N-[2-[(3-chloro-2-pyridinyl)methylsulfanyl]ethyl]-2-nitro-1-N'-(2,2,2-trifluoroethyl)ethene-1,1-diamine.
| Compound Name | 1-N-[2-[(3-chloro-2-pyridinyl)methylsulfanyl]ethyl]-2-nitro-1-N'-(2,2,2-trifluoroethyl)ethene-1,1-diamine |
|---|---|
| PubChem CID | 70508656 |
| Molecular Formula | C12H14ClF3N4O2S |
| Molecular Weight | 370.78 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | 1-N-[2-[(3-chloro-2-pyridinyl)methylsulfanyl]ethyl]-2-nitro-1-N'-(2,2,2-trifluoroethyl)ethene-1,1-diamine |
| SMILES | O=[N+]([O-])C=C(NCCSCc1ncccc1Cl)NCC(F)(F)F |
| InChI | InChI=1S/C12H14ClF3N4O2S/c13-9-2-1-3-17-10(9)7-23-5-4-18-11(6-20(21)22)19-8-12(14,15)16/h1-3,6,18-19H,4-5,7-8H2 |
| InChIKey | QHKHHNCDTXWTJQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 80.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.78 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|