C18H23N5O2S2 — CID 21435077
2-nitro-1-N,1-N'-bis[2-(pyridin-2-ylmethylsulfanyl)ethyl]ethene-1,1-diamine (PubChem CID 21435077) has the molecular formula C18H23N5O2S2 and a molecular weight of 405.55 g/mol. Its IUPAC name is 2-nitro-1-N,1-N'-bis[2-(pyridin-2-ylmethylsulfanyl)ethyl]ethene-1,1-diamine.
| Compound Name | 2-nitro-1-N,1-N'-bis[2-(pyridin-2-ylmethylsulfanyl)ethyl]ethene-1,1-diamine |
|---|---|
| PubChem CID | 21435077 |
| Molecular Formula | C18H23N5O2S2 |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 2-nitro-1-N,1-N'-bis[2-(pyridin-2-ylmethylsulfanyl)ethyl]ethene-1,1-diamine |
| SMILES | O=[N+]([O-])C=C(NCCSCc1ccccn1)NCCSCc1ccccn1 |
| InChI | InChI=1S/C18H23N5O2S2/c24-23(25)13-18(21-9-11-26-14-16-5-1-3-7-19-16)22-10-12-27-15-17-6-2-4-8-20-17/h1-8,13,21-22H,9-12,14-15H2 |
| InChIKey | CKLORZZKRYMILK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 92.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|