C15H19ClN6O2S3 — CID 70623595
1-N-[2-[(3-chloro-2-pyridinyl)methylsulfanyl]ethyl]-2-nitro-1-N'-[2-(1,3,4-thiadiazol-2-ylmethylsulfanyl)ethyl]ethene-1,1-diamine (PubChem CID 70623595) has the molecular formula C15H19ClN6O2S3 and a molecular weight of 447.01 g/mol. Its IUPAC name is 1-N-[2-[(3-chloro-2-pyridinyl)methylsulfanyl]ethyl]-2-nitro-1-N'-[2-(1,3,4-thiadiazol-2-ylmethylsulfanyl)ethyl]ethene-1,1-diamine.
| Compound Name | 1-N-[2-[(3-chloro-2-pyridinyl)methylsulfanyl]ethyl]-2-nitro-1-N'-[2-(1,3,4-thiadiazol-2-ylmethylsulfanyl)ethyl]ethene-1,1-diamine |
|---|---|
| PubChem CID | 70623595 |
| Molecular Formula | C15H19ClN6O2S3 |
| Molecular Weight | 447.01 g/mol |
| Exact Mass | 446.04 |
| IUPAC Name | 1-N-[2-[(3-chloro-2-pyridinyl)methylsulfanyl]ethyl]-2-nitro-1-N'-[2-(1,3,4-thiadiazol-2-ylmethylsulfanyl)ethyl]ethene-1,1-diamine |
| SMILES | O=[N+]([O-])C=C(NCCSCc1nncs1)NCCSCc1ncccc1Cl |
| InChI | InChI=1S/C15H19ClN6O2S3/c16-12-2-1-3-17-13(12)9-25-6-4-18-14(8-22(23)24)19-5-7-26-10-15-21-20-11-27-15/h1-3,8,11,18-19H,4-7,9-10H2 |
| InChIKey | VFZZMHUDYMPENH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 105.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.01 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|