C17H23ClN6O3S2 — CID 70624234
1-N-[2-[2-(2-amino-1,3-oxazol-5-yl)ethylsulfanyl]ethyl]-1-N'-[2-[(3-chloro-2-pyridinyl)methylsulfanyl]ethyl]-2-nitroethene-1,1-diamine (PubChem CID 70624234) has the molecular formula C17H23ClN6O3S2 and a molecular weight of 459.00 g/mol. Its IUPAC name is 1-N-[2-[2-(2-amino-1,3-oxazol-5-yl)ethylsulfanyl]ethyl]-1-N'-[2-[(3-chloro-2-pyridinyl)methylsulfanyl]ethyl]-2-nitroethene-1,1-diamine.
| Compound Name | 1-N-[2-[2-(2-amino-1,3-oxazol-5-yl)ethylsulfanyl]ethyl]-1-N'-[2-[(3-chloro-2-pyridinyl)methylsulfanyl]ethyl]-2-nitroethene-1,1-diamine |
|---|---|
| PubChem CID | 70624234 |
| Molecular Formula | C17H23ClN6O3S2 |
| Molecular Weight | 459.00 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | 1-N-[2-[2-(2-amino-1,3-oxazol-5-yl)ethylsulfanyl]ethyl]-1-N'-[2-[(3-chloro-2-pyridinyl)methylsulfanyl]ethyl]-2-nitroethene-1,1-diamine |
| SMILES | Nc1ncc(CCSCCNC(=C[N+](=O)[O-])NCCSCc2ncccc2Cl)o1 |
| InChI | InChI=1S/C17H23ClN6O3S2/c18-14-2-1-4-20-15(14)12-29-9-6-22-16(11-24(25)26)21-5-8-28-7-3-13-10-23-17(19)27-13/h1-2,4,10-11,21-22H,3,5-9,12H2,(H2,19,23) |
| InChIKey | VDBDUBGUUMPBKA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 132.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.00 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|