C10H17N5O3S — CID 20550207
(Z)-1-N'-[2-[2-(2-amino-1,3-oxazol-5-yl)ethylsulfanyl]ethyl]-1-N-methyl-2-nitroethene-1,1-diamine (PubChem CID 20550207) has the molecular formula C10H17N5O3S and a molecular weight of 287.34 g/mol. Its IUPAC name is (Z)-1-N'-[2-[2-(2-amino-1,3-oxazol-5-yl)ethylsulfanyl]ethyl]-1-N-methyl-2-nitroethene-1,1-diamine.
| Compound Name | (Z)-1-N'-[2-[2-(2-amino-1,3-oxazol-5-yl)ethylsulfanyl]ethyl]-1-N-methyl-2-nitroethene-1,1-diamine |
|---|---|
| PubChem CID | 20550207 |
| Molecular Formula | C10H17N5O3S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | (Z)-1-N'-[2-[2-(2-amino-1,3-oxazol-5-yl)ethylsulfanyl]ethyl]-1-N-methyl-2-nitroethene-1,1-diamine |
| SMILES | CN/C(=C/[N+](=O)[O-])NCCSCCc1cnc(N)o1 |
| InChI | InChI=1S/C10H17N5O3S/c1-12-9(7-15(16)17)13-3-5-19-4-2-8-6-14-10(11)18-8/h6-7,12-13H,2-5H2,1H3,(H2,11,14)/b9-7- |
| InChIKey | VOFAWCOYEGWVFH-CLFYSBASSA-N |
| XLogP | 0.42 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|