C12H16ClN3O2S — CID 21388312
4-(3-chloro-2-pyridinyl)-N-[(E)-1-methylsulfanyl-2-nitroethenyl]butan-1-amine (PubChem CID 21388312) has the molecular formula C12H16ClN3O2S and a molecular weight of 301.80 g/mol. Its IUPAC name is 4-(3-chloro-2-pyridinyl)-N-[(E)-1-methylsulfanyl-2-nitroethenyl]butan-1-amine.
| Compound Name | 4-(3-chloro-2-pyridinyl)-N-[(E)-1-methylsulfanyl-2-nitroethenyl]butan-1-amine |
|---|---|
| PubChem CID | 21388312 |
| Molecular Formula | C12H16ClN3O2S |
| Molecular Weight | 301.80 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 4-(3-chloro-2-pyridinyl)-N-[(E)-1-methylsulfanyl-2-nitroethenyl]butan-1-amine |
| SMILES | CS/C(=C/[N+](=O)[O-])NCCCCc1ncccc1Cl |
| InChI | InChI=1S/C12H16ClN3O2S/c1-19-12(9-16(17)18)15-7-3-2-6-11-10(13)5-4-8-14-11/h4-5,8-9,15H,2-3,6-7H2,1H3/b12-9+ |
| InChIKey | MDWHFVFHORNIJA-FMIVXFBMSA-N |
| XLogP | 3.09 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.80 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|