C9H16N6O2S — CID 70509690
1-hydrazinyl-N-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-2-nitroethenamine (PubChem CID 70509690) has the molecular formula C9H16N6O2S and a molecular weight of 272.33 g/mol. Its IUPAC name is 1-hydrazinyl-N-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-2-nitroethenamine.
| Compound Name | 1-hydrazinyl-N-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-2-nitroethenamine |
|---|---|
| PubChem CID | 70509690 |
| Molecular Formula | C9H16N6O2S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 1-hydrazinyl-N-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-2-nitroethenamine |
| SMILES | Cc1[nH]cnc1CSCCNC(=C[N+](=O)[O-])NN |
| InChI | InChI=1S/C9H16N6O2S/c1-7-8(13-6-12-7)5-18-3-2-11-9(14-10)4-15(16)17/h4,6,11,14H,2-3,5,10H2,1H3,(H,12,13) |
| InChIKey | PESAHNYPLZUGBS-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 121.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imidazole_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|