C16H20ClN3O2S3 — CID 70542297
2-(4-chlorophenyl)sulfonyl-N-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-1-methylsulfanylethenamine (PubChem CID 70542297) has the molecular formula C16H20ClN3O2S3 and a molecular weight of 418.01 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfonyl-N-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-1-methylsulfanylethenamine.
| Compound Name | 2-(4-chlorophenyl)sulfonyl-N-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-1-methylsulfanylethenamine |
|---|---|
| PubChem CID | 70542297 |
| Molecular Formula | C16H20ClN3O2S3 |
| Molecular Weight | 418.01 g/mol |
| Exact Mass | 417.04 |
| IUPAC Name | 2-(4-chlorophenyl)sulfonyl-N-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-1-methylsulfanylethenamine |
| SMILES | CSC(=CS(=O)(=O)c1ccc(Cl)cc1)NCCSCc1nc[nH]c1C |
| InChI | InChI=1S/C16H20ClN3O2S3/c1-12-15(20-11-19-12)9-24-8-7-18-16(23-2)10-25(21,22)14-5-3-13(17)4-6-14/h3-6,10-11,18H,7-9H2,1-2H3,(H,19,20) |
| InChIKey | RKFYGIRMYCWMIT-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.01 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imidazole_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|