C17H18ClN3O2S3 — CID 88787457
2-(4-chlorophenyl)sulfonyl-1-N'-prop-2-ynyl-1-N-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]ethene-1,1-diamine (PubChem CID 88787457) has the molecular formula C17H18ClN3O2S3 and a molecular weight of 428.00 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfonyl-1-N'-prop-2-ynyl-1-N-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]ethene-1,1-diamine.
| Compound Name | 2-(4-chlorophenyl)sulfonyl-1-N'-prop-2-ynyl-1-N-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]ethene-1,1-diamine |
|---|---|
| PubChem CID | 88787457 |
| Molecular Formula | C17H18ClN3O2S3 |
| Molecular Weight | 428.00 g/mol |
| Exact Mass | 427.02 |
| IUPAC Name | 2-(4-chlorophenyl)sulfonyl-1-N'-prop-2-ynyl-1-N-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]ethene-1,1-diamine |
| SMILES | C#CCNC(=CS(=O)(=O)c1ccc(Cl)cc1)NCCSCc1nccs1 |
| InChI | InChI=1S/C17H18ClN3O2S3/c1-2-7-19-16(20-8-10-24-12-17-21-9-11-25-17)13-26(22,23)15-5-3-14(18)4-6-15/h1,3-6,9,11,13,19-20H,7-8,10,12H2 |
| InChIKey | NFKPIWOFHBQXDB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.00 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|