C14H19N5O3S4 — CID 70620510
2-nitro-1-N-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]-1-N'-[2-(1,3-thiazol-2-ylmethylsulfinyl)ethyl]ethene-1,1-diamine (PubChem CID 70620510) has the molecular formula C14H19N5O3S4 and a molecular weight of 433.61 g/mol. Its IUPAC name is 2-nitro-1-N-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]-1-N'-[2-(1,3-thiazol-2-ylmethylsulfinyl)ethyl]ethene-1,1-diamine.
| Compound Name | 2-nitro-1-N-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]-1-N'-[2-(1,3-thiazol-2-ylmethylsulfinyl)ethyl]ethene-1,1-diamine |
|---|---|
| PubChem CID | 70620510 |
| Molecular Formula | C14H19N5O3S4 |
| Molecular Weight | 433.61 g/mol |
| Exact Mass | 433.04 |
| IUPAC Name | 2-nitro-1-N-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]-1-N'-[2-(1,3-thiazol-2-ylmethylsulfinyl)ethyl]ethene-1,1-diamine |
| SMILES | O=[N+]([O-])C=C(NCCSCc1nccs1)NCCS(=O)Cc1nccs1 |
| InChI | InChI=1S/C14H19N5O3S4/c20-19(21)9-12(15-1-5-23-10-13-17-2-6-24-13)16-4-8-26(22)11-14-18-3-7-25-14/h2-3,6-7,9,15-16H,1,4-5,8,10-11H2 |
| InChIKey | GCCHDHAOERBUMD-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 110.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.61 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|