C11H14BrN5O2S — CID 23342758
(Z)-1-N-[2-[(4-bromo-1H-imidazol-5-yl)methylsulfanyl]ethyl]-2-nitro-1-N'-prop-2-ynylethene-1,1-diamine (PubChem CID 23342758) has the molecular formula C11H14BrN5O2S and a molecular weight of 360.24 g/mol. Its IUPAC name is (Z)-1-N-[2-[(4-bromo-1H-imidazol-5-yl)methylsulfanyl]ethyl]-2-nitro-1-N'-prop-2-ynylethene-1,1-diamine.
| Compound Name | (Z)-1-N-[2-[(4-bromo-1H-imidazol-5-yl)methylsulfanyl]ethyl]-2-nitro-1-N'-prop-2-ynylethene-1,1-diamine |
|---|---|
| PubChem CID | 23342758 |
| Molecular Formula | C11H14BrN5O2S |
| Molecular Weight | 360.24 g/mol |
| Exact Mass | 359.01 |
| IUPAC Name | (Z)-1-N-[2-[(4-bromo-1H-imidazol-5-yl)methylsulfanyl]ethyl]-2-nitro-1-N'-prop-2-ynylethene-1,1-diamine |
| SMILES | C#CCN/C(=C/[N+](=O)[O-])NCCSCc1[nH]cnc1Br |
| InChI | InChI=1S/C11H14BrN5O2S/c1-2-3-13-10(6-17(18)19)14-4-5-20-7-9-11(12)16-8-15-9/h1,6,8,13-14H,3-5,7H2,(H,15,16)/b10-6- |
| InChIKey | IHCAOXAGEJKFAB-POHAHGRESA-N |
| XLogP | 1.29 |
| TPSA | 95.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.24 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|