C14H19Br2N7O3S2 — CID 70621219
1-N-[2-[(4-bromo-1H-imidazol-5-yl)methylsulfanyl]ethyl]-1-N'-[2-[(4-bromo-1H-imidazol-5-yl)methylsulfinyl]ethyl]-2-nitroethene-1,1-diamine (PubChem CID 70621219) has the molecular formula C14H19Br2N7O3S2 and a molecular weight of 557.29 g/mol. Its IUPAC name is 1-N-[2-[(4-bromo-1H-imidazol-5-yl)methylsulfanyl]ethyl]-1-N'-[2-[(4-bromo-1H-imidazol-5-yl)methylsulfinyl]ethyl]-2-nitroethene-1,1-diamine.
| Compound Name | 1-N-[2-[(4-bromo-1H-imidazol-5-yl)methylsulfanyl]ethyl]-1-N'-[2-[(4-bromo-1H-imidazol-5-yl)methylsulfinyl]ethyl]-2-nitroethene-1,1-diamine |
|---|---|
| PubChem CID | 70621219 |
| Molecular Formula | C14H19Br2N7O3S2 |
| Molecular Weight | 557.29 g/mol |
| Exact Mass | 554.94 |
| IUPAC Name | 1-N-[2-[(4-bromo-1H-imidazol-5-yl)methylsulfanyl]ethyl]-1-N'-[2-[(4-bromo-1H-imidazol-5-yl)methylsulfinyl]ethyl]-2-nitroethene-1,1-diamine |
| SMILES | O=[N+]([O-])C=C(NCCSCc1[nH]cnc1Br)NCCS(=O)Cc1[nH]cnc1Br |
| InChI | InChI=1S/C14H19Br2N7O3S2/c15-13-10(19-8-21-13)6-27-3-1-17-12(5-23(24)25)18-2-4-28(26)7-11-14(16)22-9-20-11/h5,8-9,17-18H,1-4,6-7H2,(H,19,21)(H,20,22) |
| InChIKey | FGTHLPFJTSYTCU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 141.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.29 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|