C8H13BrN4O3S2 — CID 20507755
[2-[(4-bromo-1H-imidazol-5-yl)methylsulfanyl]ethylamino]-methyliminomethanesulfonic acid (PubChem CID 20507755) has the molecular formula C8H13BrN4O3S2 and a molecular weight of 357.26 g/mol. Its IUPAC name is [2-[(4-bromo-1H-imidazol-5-yl)methylsulfanyl]ethylamino]-methyliminomethanesulfonic acid.
| Compound Name | [2-[(4-bromo-1H-imidazol-5-yl)methylsulfanyl]ethylamino]-methyliminomethanesulfonic acid |
|---|---|
| PubChem CID | 20507755 |
| Molecular Formula | C8H13BrN4O3S2 |
| Molecular Weight | 357.26 g/mol |
| Exact Mass | 355.96 |
| IUPAC Name | [2-[(4-bromo-1H-imidazol-5-yl)methylsulfanyl]ethylamino]-methyliminomethanesulfonic acid |
| SMILES | C/N=C(\NCCSCc1[nH]cnc1Br)S(=O)(=O)O |
| InChI | InChI=1S/C8H13BrN4O3S2/c1-10-8(18(14,15)16)11-2-3-17-4-6-7(9)13-5-12-6/h5H,2-4H2,1H3,(H,10,11)(H,12,13)(H,14,15,16) |
| InChIKey | PMDBYYVQBRRKRD-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.26 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|