C7H14N6OS — CID 54560230
1-hydroxy-2-methyl-3-[2-(1H-1,2,4-triazol-5-ylmethylsulfanyl)ethyl]guanidine (PubChem CID 54560230) has the molecular formula C7H14N6OS and a molecular weight of 230.30 g/mol. Its IUPAC name is 1-hydroxy-2-methyl-3-[2-(1H-1,2,4-triazol-5-ylmethylsulfanyl)ethyl]guanidine.
| Compound Name | 1-hydroxy-2-methyl-3-[2-(1H-1,2,4-triazol-5-ylmethylsulfanyl)ethyl]guanidine |
|---|---|
| PubChem CID | 54560230 |
| Molecular Formula | C7H14N6OS |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 1-hydroxy-2-methyl-3-[2-(1H-1,2,4-triazol-5-ylmethylsulfanyl)ethyl]guanidine |
| SMILES | C/N=C(\NO)NCCSCc1ncn[nH]1 |
| InChI | InChI=1S/C7H14N6OS/c1-8-7(13-14)9-2-3-15-4-6-10-5-11-12-6/h5,14H,2-4H2,1H3,(H2,8,9,13)(H,10,11,12) |
| InChIKey | ZQALJDUTNOKKFL-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|