C6H11N3S — CID 146611775
5-(propan-2-ylsulfanylmethyl)-1H-1,2,4-triazole (PubChem CID 146611775) has the molecular formula C6H11N3S and a molecular weight of 157.24 g/mol. Its IUPAC name is 5-(propan-2-ylsulfanylmethyl)-1H-1,2,4-triazole.
| Compound Name | 5-(propan-2-ylsulfanylmethyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 146611775 |
| Molecular Formula | C6H11N3S |
| Molecular Weight | 157.24 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | 5-(propan-2-ylsulfanylmethyl)-1H-1,2,4-triazole |
| SMILES | CC(C)SCc1ncn[nH]1 |
| InChI | InChI=1S/C6H11N3S/c1-5(2)10-3-6-7-4-8-9-6/h4-5H,3H2,1-2H3,(H,7,8,9) |
| InChIKey | BVVDFXZZZDQFKL-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.24 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |