C18H21N9 — CID 171783575
5-[[2,4,6-trimethyl-3,5-bis(1H-1,2,4-triazol-5-ylmethyl)phenyl]methyl]-1H-1,2,4-triazole (PubChem CID 171783575) has the molecular formula C18H21N9 and a molecular weight of 363.43 g/mol. Its IUPAC name is 5-[[2,4,6-trimethyl-3,5-bis(1H-1,2,4-triazol-5-ylmethyl)phenyl]methyl]-1H-1,2,4-triazole.
| Compound Name | 5-[[2,4,6-trimethyl-3,5-bis(1H-1,2,4-triazol-5-ylmethyl)phenyl]methyl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 171783575 |
| Molecular Formula | C18H21N9 |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | 5-[[2,4,6-trimethyl-3,5-bis(1H-1,2,4-triazol-5-ylmethyl)phenyl]methyl]-1H-1,2,4-triazole |
| SMILES | Cc1c(Cc2ncn[nH]2)c(C)c(Cc2ncn[nH]2)c(C)c1Cc1ncn[nH]1 |
| InChI | InChI=1S/C18H21N9/c1-10-13(4-16-19-7-22-25-16)11(2)15(6-18-21-9-24-27-18)12(3)14(10)5-17-20-8-23-26-17/h7-9H,4-6H2,1-3H3,(H,19,22,25)(H,20,23,26)(H,21,24,27) |
| InChIKey | UMVXZYOKBHTWNS-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 124.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |