C5H7N3O — CID 67831911
3-(1H-1,2,4-triazol-5-yl)prop-1-en-2-ol (PubChem CID 67831911) has the molecular formula C5H7N3O and a molecular weight of 125.13 g/mol. Its IUPAC name is 3-(1H-1,2,4-triazol-5-yl)prop-1-en-2-ol.
| Compound Name | 3-(1H-1,2,4-triazol-5-yl)prop-1-en-2-ol |
|---|---|
| PubChem CID | 67831911 |
| Molecular Formula | C5H7N3O |
| Molecular Weight | 125.13 g/mol |
| Exact Mass | 125.06 |
| IUPAC Name | 3-(1H-1,2,4-triazol-5-yl)prop-1-en-2-ol |
| SMILES | C=C(O)Cc1ncn[nH]1 |
| InChI | InChI=1S/C5H7N3O/c1-4(9)2-5-6-3-7-8-5/h3,9H,1-2H2,(H,6,7,8) |
| InChIKey | LQCFWUMRDVCUNA-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.13 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|