C3H5N3O3P+ — CID 70645510
hydroxy-oxo-(1H-1,2,4-triazol-5-ylmethoxy)phosphanium (PubChem CID 70645510) has the molecular formula C3H5N3O3P+ and a molecular weight of 162.06 g/mol. Its IUPAC name is hydroxy-oxo-(1H-1,2,4-triazol-5-ylmethoxy)phosphanium.
| Compound Name | hydroxy-oxo-(1H-1,2,4-triazol-5-ylmethoxy)phosphanium |
|---|---|
| PubChem CID | 70645510 |
| Molecular Formula | C3H5N3O3P+ |
| Molecular Weight | 162.06 g/mol |
| Exact Mass | 162.01 |
| IUPAC Name | hydroxy-oxo-(1H-1,2,4-triazol-5-ylmethoxy)phosphanium |
| SMILES | O=[P+](O)OCc1ncn[nH]1 |
| InChI | InChI=1S/C3H4N3O3P/c7-10(8)9-1-3-4-2-5-6-3/h2H,1H2,(H-,4,5,6,7,8)/p+1 |
| InChIKey | KPYAVCLPCIBJHG-UHFFFAOYSA-O |
| XLogP | -0.03 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.06 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|