C9H19N3OSi — CID 10242322
tert-butyl-dimethyl-(1H-1,2,4-triazol-5-ylmethoxy)silane (PubChem CID 10242322) has the molecular formula C9H19N3OSi and a molecular weight of 213.36 g/mol. Its IUPAC name is tert-butyl-dimethyl-(1H-1,2,4-triazol-5-ylmethoxy)silane.
| Compound Name | tert-butyl-dimethyl-(1H-1,2,4-triazol-5-ylmethoxy)silane |
|---|---|
| PubChem CID | 10242322 |
| Molecular Formula | C9H19N3OSi |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | tert-butyl-dimethyl-(1H-1,2,4-triazol-5-ylmethoxy)silane |
| SMILES | CC(C)(C)[Si](C)(C)OCc1ncn[nH]1 |
| InChI | InChI=1S/C9H19N3OSi/c1-9(2,3)14(4,5)13-6-8-10-7-11-12-8/h7H,6H2,1-5H3,(H,10,11,12) |
| InChIKey | XKQMRIVZVLGFFZ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|