C18H36O2SSi2 — CID 10690703
tert-butyl-[[2-[[tert-butyl(dimethyl)silyl]oxymethyl]thiophen-3-yl]methoxy]-dimethylsilane (PubChem CID 10690703) has the molecular formula C18H36O2SSi2 and a molecular weight of 372.72 g/mol. Its IUPAC name is tert-butyl-[[2-[[tert-butyl(dimethyl)silyl]oxymethyl]thiophen-3-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[2-[[tert-butyl(dimethyl)silyl]oxymethyl]thiophen-3-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10690703 |
| Molecular Formula | C18H36O2SSi2 |
| Molecular Weight | 372.72 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | tert-butyl-[[2-[[tert-butyl(dimethyl)silyl]oxymethyl]thiophen-3-yl]methoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCc1ccsc1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H36O2SSi2/c1-17(2,3)22(7,8)19-13-15-11-12-21-16(15)14-20-23(9,10)18(4,5)6/h11-12H,13-14H2,1-10H3 |
| InChIKey | DEOPBSOYTAANJS-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.72 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|