C10H18INOSSi — CID 53416358
tert-butyl-[(2-iodo-1,3-thiazol-4-yl)methoxy]-dimethylsilane (PubChem CID 53416358) has the molecular formula C10H18INOSSi and a molecular weight of 355.32 g/mol. Its IUPAC name is tert-butyl-[(2-iodo-1,3-thiazol-4-yl)methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2-iodo-1,3-thiazol-4-yl)methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 53416358 |
| Molecular Formula | C10H18INOSSi |
| Molecular Weight | 355.32 g/mol |
| Exact Mass | 354.99 |
| IUPAC Name | tert-butyl-[(2-iodo-1,3-thiazol-4-yl)methoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCc1csc(I)n1 |
| InChI | InChI=1S/C10H18INOSSi/c1-10(2,3)15(4,5)13-6-8-7-14-9(11)12-8/h7H,6H2,1-5H3 |
| InChIKey | VSGUNQSEXUIIEI-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.32 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|