C20H24N2O4SSi — CID 159902262
3-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3-thiazole-2-carbonyl]indole-1-carboxylic acid (PubChem CID 159902262) has the molecular formula C20H24N2O4SSi and a molecular weight of 416.58 g/mol. Its IUPAC name is 3-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3-thiazole-2-carbonyl]indole-1-carboxylic acid.
| Compound Name | 3-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3-thiazole-2-carbonyl]indole-1-carboxylic acid |
|---|---|
| PubChem CID | 159902262 |
| Molecular Formula | C20H24N2O4SSi |
| Molecular Weight | 416.58 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 3-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3-thiazole-2-carbonyl]indole-1-carboxylic acid |
| SMILES | CC(C)(C)[Si](C)(C)OCc1csc(C(=O)c2cn(C(=O)O)c3ccccc23)n1 |
| InChI | InChI=1S/C20H24N2O4SSi/c1-20(2,3)28(4,5)26-11-13-12-27-18(21-13)17(23)15-10-22(19(24)25)16-9-7-6-8-14(15)16/h6-10,12H,11H2,1-5H3,(H,24,25) |
| InChIKey | NWCPGYAIRPSKJH-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.58 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|