C14H9ClN4O4S — CID 155269980
5-chloro-3-[4-[(E)-N'-hydroxycarbamimidoyl]-1,3-thiazole-2-carbonyl]indole-1-carboxylic acid (PubChem CID 155269980) has the molecular formula C14H9ClN4O4S and a molecular weight of 364.77 g/mol. Its IUPAC name is 5-chloro-3-[4-[(E)-N'-hydroxycarbamimidoyl]-1,3-thiazole-2-carbonyl]indole-1-carboxylic acid.
| Compound Name | 5-chloro-3-[4-[(E)-N'-hydroxycarbamimidoyl]-1,3-thiazole-2-carbonyl]indole-1-carboxylic acid |
|---|---|
| PubChem CID | 155269980 |
| Molecular Formula | C14H9ClN4O4S |
| Molecular Weight | 364.77 g/mol |
| Exact Mass | 364.00 |
| IUPAC Name | 5-chloro-3-[4-[(E)-N'-hydroxycarbamimidoyl]-1,3-thiazole-2-carbonyl]indole-1-carboxylic acid |
| SMILES | N/C(=N/O)c1csc(C(=O)c2cn(C(=O)O)c3ccc(Cl)cc23)n1 |
| InChI | InChI=1S/C14H9ClN4O4S/c15-6-1-2-10-7(3-6)8(4-19(10)14(21)22)11(20)13-17-9(5-24-13)12(16)18-23/h1-5,23H,(H2,16,18)(H,21,22) |
| InChIKey | QIQHKQOCWDUQDA-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 130.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.77 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|