C13H11ClN2O3S — CID 168886969
ethyl 2-(2-amino-4-chlorobenzoyl)-1,3-thiazole-4-carboxylate (PubChem CID 168886969) has the molecular formula C13H11ClN2O3S and a molecular weight of 310.76 g/mol. Its IUPAC name is ethyl 2-(2-amino-4-chlorobenzoyl)-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-(2-amino-4-chlorobenzoyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 168886969 |
| Molecular Formula | C13H11ClN2O3S |
| Molecular Weight | 310.76 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | ethyl 2-(2-amino-4-chlorobenzoyl)-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(C(=O)c2ccc(Cl)cc2N)n1 |
| InChI | InChI=1S/C13H11ClN2O3S/c1-2-19-13(18)10-6-20-12(16-10)11(17)8-4-3-7(14)5-9(8)15/h3-6H,2,15H2,1H3 |
| InChIKey | JCRPYQLRJLGILP-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.76 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|