C13H12ClNO3S — CID 106819010
ethyl 2-(4-chloro-2-methoxyphenyl)-1,3-thiazole-4-carboxylate (PubChem CID 106819010) has the molecular formula C13H12ClNO3S and a molecular weight of 297.76 g/mol. Its IUPAC name is ethyl 2-(4-chloro-2-methoxyphenyl)-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-(4-chloro-2-methoxyphenyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 106819010 |
| Molecular Formula | C13H12ClNO3S |
| Molecular Weight | 297.76 g/mol |
| Exact Mass | 297.02 |
| IUPAC Name | ethyl 2-(4-chloro-2-methoxyphenyl)-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(-c2ccc(Cl)cc2OC)n1 |
| InChI | InChI=1S/C13H12ClNO3S/c1-3-18-13(16)10-7-19-12(15-10)9-5-4-8(14)6-11(9)17-2/h4-7H,3H2,1-2H3 |
| InChIKey | SKFLYLLLJLPTJU-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.76 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |