About ethyl 2-(4-ethoxynaphthalen-1-yl)-1,3-thiazole-4-carboxylate;N-methylmethanamine
ethyl 2-(4-ethoxynaphthalen-1-yl)-1,3-thiazole-4-carboxylate;N-methylmethanamine (PubChem CID 70160605) has the molecular formula C20H24N2O3S
and a molecular weight of 372.49 g/mol. Its IUPAC name is ethyl 2-(4-ethoxynaphthalen-1-yl)-1,3-thiazole-4-carboxylate;N-methylmethanamine.
Molecular Properties
| Compound Name | ethyl 2-(4-ethoxynaphthalen-1-yl)-1,3-thiazole-4-carboxylate;N-methylmethanamine |
| PubChem CID | 70160605 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | ethyl 2-(4-ethoxynaphthalen-1-yl)-1,3-thiazole-4-carboxylate;N-methylmethanamine |
| SMILES | CCOC(=O)c1csc(-c2ccc(OCC)c3ccccc23)n1.CNC |
| InChI | InChI=1S/C18H17NO3S.C2H7N/c1-3-21-16-10-9-14(12-7-5-6-8-13(12)16)17-19-15(11-23-17)18(20)22-4-2;1-3-2/h5-11H,3-4H2,1-2H3;3H,1-2H3 |
| InChIKey | IBPQVKLIJCDOHH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 2-(4-ethoxynaphthalen-1-yl)-1,3-thiazole-4-carboxylate;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(4-ethoxynaphthalen-1-yl)-1,3-thiazole-4-carboxylate;N-methylmethanamine?
The IUPAC name of ethyl 2-(4-ethoxynaphthalen-1-yl)-1,3-thiazole-4-carboxylate;N-methylmethanamine (CID 70160605) is ethyl 2-(4-ethoxynaphthalen-1-yl)-1,3-thiazole-4-carboxylate;N-methylmethanamine.
What is the SMILES notation for ethyl 2-(4-ethoxynaphthalen-1-yl)-1,3-thiazole-4-carboxylate;N-methylmethanamine?
The canonical SMILES for ethyl 2-(4-ethoxynaphthalen-1-yl)-1,3-thiazole-4-carboxylate;N-methylmethanamine is CCOC(=O)c1csc(-c2ccc(OCC)c3ccccc23)n1.CNC.
What is the InChIKey of ethyl 2-(4-ethoxynaphthalen-1-yl)-1,3-thiazole-4-carboxylate;N-methylmethanamine?
The InChIKey is IBPQVKLIJCDOHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17NO3S.C2H7N/c1-3-21-16-10-9-14(12-7-5-6-8-13(12)16)17-19-15(11-23-17)18(20)22-4-2;1-3-2/h5-11H,3-4H2,1-2H3;3H,1-2H3.
What are the key properties of ethyl 2-(4-ethoxynaphthalen-1-yl)-1,3-thiazole-4-carboxylate;N-methylmethanamine?
ethyl 2-(4-ethoxynaphthalen-1-yl)-1,3-thiazole-4-carboxylate;N-methylmethanamine has a molecular weight of 372.49 g/mol, XLogP of 4.37, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(4-ethoxynaphthalen-1-yl)-1,3-thiazole-4-carboxylate;N-methylmethanamine is sourced from PubChem (CID 70160605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).