C11H8Cl2N2O2S — CID 169498589
ethyl 2-(4,6-dichloro-2-pyridinyl)-1,3-thiazole-4-carboxylate (PubChem CID 169498589) has the molecular formula C11H8Cl2N2O2S and a molecular weight of 303.17 g/mol. Its IUPAC name is ethyl 2-(4,6-dichloro-2-pyridinyl)-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-(4,6-dichloro-2-pyridinyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 169498589 |
| Molecular Formula | C11H8Cl2N2O2S |
| Molecular Weight | 303.17 g/mol |
| Exact Mass | 301.97 |
| IUPAC Name | ethyl 2-(4,6-dichloro-2-pyridinyl)-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(-c2cc(Cl)cc(Cl)n2)n1 |
| InChI | InChI=1S/C11H8Cl2N2O2S/c1-2-17-11(16)8-5-18-10(15-8)7-3-6(12)4-9(13)14-7/h3-5H,2H2,1H3 |
| InChIKey | CFOBDSGFGHMHNQ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.17 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|