C10H8ClNO2S2 — CID 78974871
ethyl 2-(5-chlorothiophen-2-yl)-1,3-thiazole-4-carboxylate (PubChem CID 78974871) has the molecular formula C10H8ClNO2S2 and a molecular weight of 273.77 g/mol. Its IUPAC name is ethyl 2-(5-chlorothiophen-2-yl)-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-(5-chlorothiophen-2-yl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 78974871 |
| Molecular Formula | C10H8ClNO2S2 |
| Molecular Weight | 273.77 g/mol |
| Exact Mass | 272.97 |
| IUPAC Name | ethyl 2-(5-chlorothiophen-2-yl)-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(-c2ccc(Cl)s2)n1 |
| InChI | InChI=1S/C10H8ClNO2S2/c1-2-14-10(13)6-5-15-9(12-6)7-3-4-8(11)16-7/h3-5H,2H2,1H3 |
| InChIKey | ICEJRRMAXIPKPO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.77 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |