C11H12ClN3OS2 — CID 119408363
N-(3-aminopropyl)-2-(5-chlorothiophen-2-yl)-1,3-thiazole-4-carboxamide (PubChem CID 119408363) has the molecular formula C11H12ClN3OS2 and a molecular weight of 301.82 g/mol. Its IUPAC name is N-(3-aminopropyl)-2-(5-chlorothiophen-2-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-(3-aminopropyl)-2-(5-chlorothiophen-2-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 119408363 |
| Molecular Formula | C11H12ClN3OS2 |
| Molecular Weight | 301.82 g/mol |
| Exact Mass | 301.01 |
| IUPAC Name | N-(3-aminopropyl)-2-(5-chlorothiophen-2-yl)-1,3-thiazole-4-carboxamide |
| SMILES | NCCCNC(=O)c1csc(-c2ccc(Cl)s2)n1 |
| InChI | InChI=1S/C11H12ClN3OS2/c12-9-3-2-8(18-9)11-15-7(6-17-11)10(16)14-5-1-4-13/h2-3,6H,1,4-5,13H2,(H,14,16) |
| InChIKey | GEKNEFWVSJZLAF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.82 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|