C11H11ClN2O2S2 — CID 110904430
2-(5-chlorothiophen-2-yl)-N-(3-hydroxypropyl)-1,3-thiazole-4-carboxamide (PubChem CID 110904430) has the molecular formula C11H11ClN2O2S2 and a molecular weight of 302.81 g/mol. Its IUPAC name is 2-(5-chlorothiophen-2-yl)-N-(3-hydroxypropyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(5-chlorothiophen-2-yl)-N-(3-hydroxypropyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 110904430 |
| Molecular Formula | C11H11ClN2O2S2 |
| Molecular Weight | 302.81 g/mol |
| Exact Mass | 302.00 |
| IUPAC Name | 2-(5-chlorothiophen-2-yl)-N-(3-hydroxypropyl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NCCCO)c1csc(-c2ccc(Cl)s2)n1 |
| InChI | InChI=1S/C11H11ClN2O2S2/c12-9-3-2-8(18-9)11-14-7(6-17-11)10(16)13-4-1-5-15/h2-3,6,15H,1,4-5H2,(H,13,16) |
| InChIKey | FTUNJXLAEMBJIN-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.81 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|