C10H9ClN2O2S2 — CID 47391839
2-(5-chlorothiophen-2-yl)-N-methoxy-N-methyl-1,3-thiazole-4-carboxamide (PubChem CID 47391839) has the molecular formula C10H9ClN2O2S2 and a molecular weight of 288.78 g/mol. Its IUPAC name is 2-(5-chlorothiophen-2-yl)-N-methoxy-N-methyl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(5-chlorothiophen-2-yl)-N-methoxy-N-methyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 47391839 |
| Molecular Formula | C10H9ClN2O2S2 |
| Molecular Weight | 288.78 g/mol |
| Exact Mass | 287.98 |
| IUPAC Name | 2-(5-chlorothiophen-2-yl)-N-methoxy-N-methyl-1,3-thiazole-4-carboxamide |
| SMILES | CON(C)C(=O)c1csc(-c2ccc(Cl)s2)n1 |
| InChI | InChI=1S/C10H9ClN2O2S2/c1-13(15-2)10(14)6-5-16-9(12-6)7-3-4-8(11)17-7/h3-5H,1-2H3 |
| InChIKey | PMURXMCGWHQTLB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.78 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|