C20H30N4O4S2 — CID 134850734
N-methoxy-2-[8-[4-[methoxy(methyl)carbamoyl]-1,3-thiazol-2-yl]octyl]-N-methyl-1,3-thiazole-4-carboxamide (PubChem CID 134850734) has the molecular formula C20H30N4O4S2 and a molecular weight of 454.62 g/mol. Its IUPAC name is N-methoxy-2-[8-[4-[methoxy(methyl)carbamoyl]-1,3-thiazol-2-yl]octyl]-N-methyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-methoxy-2-[8-[4-[methoxy(methyl)carbamoyl]-1,3-thiazol-2-yl]octyl]-N-methyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 134850734 |
| Molecular Formula | C20H30N4O4S2 |
| Molecular Weight | 454.62 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | N-methoxy-2-[8-[4-[methoxy(methyl)carbamoyl]-1,3-thiazol-2-yl]octyl]-N-methyl-1,3-thiazole-4-carboxamide |
| SMILES | CON(C)C(=O)c1csc(CCCCCCCCc2nc(C(=O)N(C)OC)cs2)n1 |
| InChI | InChI=1S/C20H30N4O4S2/c1-23(27-3)19(25)15-13-29-17(21-15)11-9-7-5-6-8-10-12-18-22-16(14-30-18)20(26)24(2)28-4/h13-14H,5-12H2,1-4H3 |
| InChIKey | PKNIVKROQIKLQT-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 84.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.62 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|