C18H17ClN4O4S — CID 155636535
tert-butyl 5-chloro-3-[4-[(Z)-N'-hydroxycarbamimidoyl]-1,3-thiazole-2-carbonyl]indole-1-carboxylate (PubChem CID 155636535) has the molecular formula C18H17ClN4O4S and a molecular weight of 420.88 g/mol. Its IUPAC name is tert-butyl 5-chloro-3-[4-[(Z)-N'-hydroxycarbamimidoyl]-1,3-thiazole-2-carbonyl]indole-1-carboxylate.
| Compound Name | tert-butyl 5-chloro-3-[4-[(Z)-N'-hydroxycarbamimidoyl]-1,3-thiazole-2-carbonyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 155636535 |
| Molecular Formula | C18H17ClN4O4S |
| Molecular Weight | 420.88 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | tert-butyl 5-chloro-3-[4-[(Z)-N'-hydroxycarbamimidoyl]-1,3-thiazole-2-carbonyl]indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(C(=O)c2nc(/C(N)=N/O)cs2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C18H17ClN4O4S/c1-18(2,3)27-17(25)23-7-11(10-6-9(19)4-5-13(10)23)14(24)16-21-12(8-28-16)15(20)22-26/h4-8,26H,1-3H3,(H2,20,22) |
| InChIKey | VHFPCTJJQPBPOX-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.88 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|