C18H16N2O4S — CID 151495035
tert-butyl 3-(4-formyl-1,3-thiazole-2-carbonyl)indole-1-carboxylate (PubChem CID 151495035) has the molecular formula C18H16N2O4S and a molecular weight of 356.40 g/mol. Its IUPAC name is tert-butyl 3-(4-formyl-1,3-thiazole-2-carbonyl)indole-1-carboxylate.
| Compound Name | tert-butyl 3-(4-formyl-1,3-thiazole-2-carbonyl)indole-1-carboxylate |
|---|---|
| PubChem CID | 151495035 |
| Molecular Formula | C18H16N2O4S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | tert-butyl 3-(4-formyl-1,3-thiazole-2-carbonyl)indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(C(=O)c2nc(C=O)cs2)c2ccccc21 |
| InChI | InChI=1S/C18H16N2O4S/c1-18(2,3)24-17(23)20-8-13(12-6-4-5-7-14(12)20)15(22)16-19-11(9-21)10-25-16/h4-10H,1-3H3 |
| InChIKey | PPGBBMHWJXHFIA-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|