C15H10N2O4S2 — CID 155664074
3-(4-methylsulfanylcarbonyl-1,3-thiazole-2-carbonyl)indole-1-carboxylic acid (PubChem CID 155664074) has the molecular formula C15H10N2O4S2 and a molecular weight of 346.39 g/mol. Its IUPAC name is 3-(4-methylsulfanylcarbonyl-1,3-thiazole-2-carbonyl)indole-1-carboxylic acid.
| Compound Name | 3-(4-methylsulfanylcarbonyl-1,3-thiazole-2-carbonyl)indole-1-carboxylic acid |
|---|---|
| PubChem CID | 155664074 |
| Molecular Formula | C15H10N2O4S2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | 3-(4-methylsulfanylcarbonyl-1,3-thiazole-2-carbonyl)indole-1-carboxylic acid |
| SMILES | CSC(=O)c1csc(C(=O)c2cn(C(=O)O)c3ccccc23)n1 |
| InChI | InChI=1S/C15H10N2O4S2/c1-22-14(19)10-7-23-13(16-10)12(18)9-6-17(15(20)21)11-5-3-2-4-8(9)11/h2-7H,1H3,(H,20,21) |
| InChIKey | UBVBTVSEGZWNQY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|