C14H16ClNO3 — CID 101043387
tert-butyl 5-chloro-3-(hydroxymethyl)indole-1-carboxylate (PubChem CID 101043387) has the molecular formula C14H16ClNO3 and a molecular weight of 281.74 g/mol. Its IUPAC name is tert-butyl 5-chloro-3-(hydroxymethyl)indole-1-carboxylate.
| Compound Name | tert-butyl 5-chloro-3-(hydroxymethyl)indole-1-carboxylate |
|---|---|
| PubChem CID | 101043387 |
| Molecular Formula | C14H16ClNO3 |
| Molecular Weight | 281.74 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | tert-butyl 5-chloro-3-(hydroxymethyl)indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(CO)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C14H16ClNO3/c1-14(2,3)19-13(18)16-7-9(8-17)11-6-10(15)4-5-12(11)16/h4-7,17H,8H2,1-3H3 |
| InChIKey | MSSZEQUTTPIZDD-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.74 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |