C15H15ClN2O2 — CID 123437889
tert-butyl 6-chloro-3-(isocyanomethyl)indole-1-carboxylate (PubChem CID 123437889) has the molecular formula C15H15ClN2O2 and a molecular weight of 290.75 g/mol. Its IUPAC name is tert-butyl 6-chloro-3-(isocyanomethyl)indole-1-carboxylate.
| Compound Name | tert-butyl 6-chloro-3-(isocyanomethyl)indole-1-carboxylate |
|---|---|
| PubChem CID | 123437889 |
| Molecular Formula | C15H15ClN2O2 |
| Molecular Weight | 290.75 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | tert-butyl 6-chloro-3-(isocyanomethyl)indole-1-carboxylate |
| SMILES | [C-]#[N+]Cc1cn(C(=O)OC(C)(C)C)c2cc(Cl)ccc12 |
| InChI | InChI=1S/C15H15ClN2O2/c1-15(2,3)20-14(19)18-9-10(8-17-4)12-6-5-11(16)7-13(12)18/h5-7,9H,8H2,1-3H3 |
| InChIKey | OBQOWZXQUGYLBM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 35.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.75 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|