C16H18BrNO4 — CID 163231154
tert-butyl 6-bromo-3-(2-methoxy-2-oxoethyl)indole-1-carboxylate (PubChem CID 163231154) has the molecular formula C16H18BrNO4 and a molecular weight of 368.23 g/mol. Its IUPAC name is tert-butyl 6-bromo-3-(2-methoxy-2-oxoethyl)indole-1-carboxylate.
| Compound Name | tert-butyl 6-bromo-3-(2-methoxy-2-oxoethyl)indole-1-carboxylate |
|---|---|
| PubChem CID | 163231154 |
| Molecular Formula | C16H18BrNO4 |
| Molecular Weight | 368.23 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | tert-butyl 6-bromo-3-(2-methoxy-2-oxoethyl)indole-1-carboxylate |
| SMILES | COC(=O)Cc1cn(C(=O)OC(C)(C)C)c2cc(Br)ccc12 |
| InChI | InChI=1S/C16H18BrNO4/c1-16(2,3)22-15(20)18-9-10(7-14(19)21-4)12-6-5-11(17)8-13(12)18/h5-6,8-9H,7H2,1-4H3 |
| InChIKey | VWROIGFFPFDWFU-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.23 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |