C15H20BrN3O2 — CID 134851711
tert-butyl 5-bromo-3-(1,2-diaminoethyl)indole-1-carboxylate (PubChem CID 134851711) has the molecular formula C15H20BrN3O2 and a molecular weight of 354.25 g/mol. Its IUPAC name is tert-butyl 5-bromo-3-(1,2-diaminoethyl)indole-1-carboxylate.
| Compound Name | tert-butyl 5-bromo-3-(1,2-diaminoethyl)indole-1-carboxylate |
|---|---|
| PubChem CID | 134851711 |
| Molecular Formula | C15H20BrN3O2 |
| Molecular Weight | 354.25 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | tert-butyl 5-bromo-3-(1,2-diaminoethyl)indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(C(N)CN)c2cc(Br)ccc21 |
| InChI | InChI=1S/C15H20BrN3O2/c1-15(2,3)21-14(20)19-8-11(12(18)7-17)10-6-9(16)4-5-13(10)19/h4-6,8,12H,7,17-18H2,1-3H3 |
| InChIKey | UZYGLFWKPNKQSU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 83.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.25 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |