C17H24N2O3 — CID 153425987
tert-butyl 3-[(2S)-2-aminopropyl]-5-methoxyindole-1-carboxylate (PubChem CID 153425987) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is tert-butyl 3-[(2S)-2-aminopropyl]-5-methoxyindole-1-carboxylate.
| Compound Name | tert-butyl 3-[(2S)-2-aminopropyl]-5-methoxyindole-1-carboxylate |
|---|---|
| PubChem CID | 153425987 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | tert-butyl 3-[(2S)-2-aminopropyl]-5-methoxyindole-1-carboxylate |
| SMILES | COc1ccc2c(c1)c(C[C@H](C)N)cn2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H24N2O3/c1-11(18)8-12-10-19(16(20)22-17(2,3)4)15-7-6-13(21-5)9-14(12)15/h6-7,9-11H,8,18H2,1-5H3/t11-/m0/s1 |
| InChIKey | QLIAVVGUAJDKQO-NSHDSACASA-N |
| XLogP | 3.32 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |